C10H9NO3S — CID 749249
(2R)-2-(1,3-benzodioxol-5-yl)-1,3-thiazolidin-4-one (PubChem CID 749249) has the molecular formula C10H9NO3S and a molecular weight of 223.25 g/mol. Its IUPAC name is (2R)-2-(1,3-benzodioxol-5-yl)-1,3-thiazolidin-4-one.
| Compound Name | (2R)-2-(1,3-benzodioxol-5-yl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 749249 |
| Molecular Formula | C10H9NO3S |
| Molecular Weight | 223.25 g/mol |
| Exact Mass | 223.03 |
| IUPAC Name | (2R)-2-(1,3-benzodioxol-5-yl)-1,3-thiazolidin-4-one |
| SMILES | O=C1CS[C@H](c2ccc3c(c2)OCO3)N1 |
| InChI | InChI=1S/C10H9NO3S/c12-9-4-15-10(11-9)6-1-2-7-8(3-6)14-5-13-7/h1-3,10H,4-5H2,(H,11,12)/t10-/m1/s1 |
| InChIKey | DKSRUPUYYGWFOH-SNVBAGLBSA-N |
| XLogP | 1.28 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.25 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |