C20H14O8 — CID 92542340
(1R,3aR,4S,6aS)-1,4-bis(1,3-benzodioxol-5-yl)-1,3a,4,6a-tetrahydrofuro[3,4-c]furan-3,6-dione (PubChem CID 92542340) has the molecular formula C20H14O8 and a molecular weight of 382.32 g/mol. Its IUPAC name is (1R,3aR,4S,6aS)-1,4-bis(1,3-benzodioxol-5-yl)-1,3a,4,6a-tetrahydrofuro[3,4-c]furan-3,6-dione.
| Compound Name | (1R,3aR,4S,6aS)-1,4-bis(1,3-benzodioxol-5-yl)-1,3a,4,6a-tetrahydrofuro[3,4-c]furan-3,6-dione |
|---|---|
| PubChem CID | 92542340 |
| Molecular Formula | C20H14O8 |
| Molecular Weight | 382.32 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | (1R,3aR,4S,6aS)-1,4-bis(1,3-benzodioxol-5-yl)-1,3a,4,6a-tetrahydrofuro[3,4-c]furan-3,6-dione |
| SMILES | O=C1O[C@@H](c2ccc3c(c2)OCO3)[C@H]2C(=O)O[C@H](c3ccc4c(c3)OCO4)[C@H]12 |
| InChI | InChI=1S/C20H14O8/c21-19-15-16(18(28-19)10-2-4-12-14(6-10)26-8-24-12)20(22)27-17(15)9-1-3-11-13(5-9)25-7-23-11/h1-6,15-18H,7-8H2/t15-,16+,17-,18+ |
| InChIKey | APOQDYUENSVQGT-USTZCAOPSA-N |
| XLogP | 2.27 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.32 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |