C21H20O7 — CID 139193486
(3aR,4S,6R,6aR)-4-(1,3-benzodioxol-5-yl)-6-(3,4-dimethoxyphenyl)-3a,4,6,6a-tetrahydro-1H-furo[3,4-c]furan-3-one (PubChem CID 139193486) has the molecular formula C21H20O7 and a molecular weight of 384.38 g/mol. Its IUPAC name is (3aR,4S,6R,6aR)-4-(1,3-benzodioxol-5-yl)-6-(3,4-dimethoxyphenyl)-3a,4,6,6a-tetrahydro-1H-furo[3,4-c]furan-3-one.
| Compound Name | (3aR,4S,6R,6aR)-4-(1,3-benzodioxol-5-yl)-6-(3,4-dimethoxyphenyl)-3a,4,6,6a-tetrahydro-1H-furo[3,4-c]furan-3-one |
|---|---|
| PubChem CID | 139193486 |
| Molecular Formula | C21H20O7 |
| Molecular Weight | 384.38 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | (3aR,4S,6R,6aR)-4-(1,3-benzodioxol-5-yl)-6-(3,4-dimethoxyphenyl)-3a,4,6,6a-tetrahydro-1H-furo[3,4-c]furan-3-one |
| SMILES | COc1ccc([C@@H]2O[C@H](c3ccc4c(c3)OCO4)[C@@H]3C(=O)OC[C@@H]32)cc1OC |
| InChI | InChI=1S/C21H20O7/c1-23-14-5-3-11(7-16(14)24-2)19-13-9-25-21(22)18(13)20(28-19)12-4-6-15-17(8-12)27-10-26-15/h3-8,13,18-20H,9-10H2,1-2H3/t13-,18+,19-,20+/m0/s1 |
| InChIKey | PEWGLGXXYOZNEE-LGWHJFRWSA-N |
| XLogP | 3.03 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.38 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |