C14H16O5 — CID 162900839
(3R,3aS,6aS)-3-(3,4-dimethoxyphenyl)-3,3a,4,6a-tetrahydro-1H-furo[3,4-c]furan-6-one (PubChem CID 162900839) has the molecular formula C14H16O5 and a molecular weight of 264.28 g/mol. Its IUPAC name is (3R,3aS,6aS)-3-(3,4-dimethoxyphenyl)-3,3a,4,6a-tetrahydro-1H-furo[3,4-c]furan-6-one.
| Compound Name | (3R,3aS,6aS)-3-(3,4-dimethoxyphenyl)-3,3a,4,6a-tetrahydro-1H-furo[3,4-c]furan-6-one |
|---|---|
| PubChem CID | 162900839 |
| Molecular Formula | C14H16O5 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | (3R,3aS,6aS)-3-(3,4-dimethoxyphenyl)-3,3a,4,6a-tetrahydro-1H-furo[3,4-c]furan-6-one |
| SMILES | COc1ccc([C@@H]2OC[C@H]3C(=O)OC[C@H]32)cc1OC |
| InChI | InChI=1S/C14H16O5/c1-16-11-4-3-8(5-12(11)17-2)13-9-6-19-14(15)10(9)7-18-13/h3-5,9-10,13H,6-7H2,1-2H3/t9-,10-,13+/m1/s1 |
| InChIKey | JQQXEGDTERJIIO-BREBYQMCSA-N |
| XLogP | 1.56 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |