C24H26O6 — CID 10364225
(1S,3aS,4S,6aS)-1,4-bis(3,4-dimethoxyphenyl)-1,3,3a,4,6,6a-hexahydropentalene-2,5-dione (PubChem CID 10364225) has the molecular formula C24H26O6 and a molecular weight of 410.47 g/mol. Its IUPAC name is (1S,3aS,4S,6aS)-1,4-bis(3,4-dimethoxyphenyl)-1,3,3a,4,6,6a-hexahydropentalene-2,5-dione.
| Compound Name | (1S,3aS,4S,6aS)-1,4-bis(3,4-dimethoxyphenyl)-1,3,3a,4,6,6a-hexahydropentalene-2,5-dione |
|---|---|
| PubChem CID | 10364225 |
| Molecular Formula | C24H26O6 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | (1S,3aS,4S,6aS)-1,4-bis(3,4-dimethoxyphenyl)-1,3,3a,4,6,6a-hexahydropentalene-2,5-dione |
| SMILES | COc1ccc([C@H]2C(=O)C[C@H]3[C@@H]2CC(=O)[C@@H]3c2ccc(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C24H26O6/c1-27-19-7-5-13(9-21(19)29-3)23-15-11-18(26)24(16(15)12-17(23)25)14-6-8-20(28-2)22(10-14)30-4/h5-10,15-16,23-24H,11-12H2,1-4H3/t15-,16-,23+,24+/m0/s1 |
| InChIKey | SKAHLEJMMGQARS-QBGYIRFESA-N |
| XLogP | 3.77 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |