C22H28O4S — CID 70401013
(2R,3S,4S,5S)-2,5-bis(3,4-dimethoxyphenyl)-3,4-dimethylthiolane (PubChem CID 70401013) has the molecular formula C22H28O4S and a molecular weight of 388.53 g/mol. Its IUPAC name is (2R,3S,4S,5S)-2,5-bis(3,4-dimethoxyphenyl)-3,4-dimethylthiolane.
| Compound Name | (2R,3S,4S,5S)-2,5-bis(3,4-dimethoxyphenyl)-3,4-dimethylthiolane |
|---|---|
| PubChem CID | 70401013 |
| Molecular Formula | C22H28O4S |
| Molecular Weight | 388.53 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | (2R,3S,4S,5S)-2,5-bis(3,4-dimethoxyphenyl)-3,4-dimethylthiolane |
| SMILES | COc1ccc([C@H]2S[C@@H](c3ccc(OC)c(OC)c3)[C@@H](C)[C@@H]2C)cc1OC |
| InChI | InChI=1S/C22H28O4S/c1-13-14(2)22(16-8-10-18(24-4)20(12-16)26-6)27-21(13)15-7-9-17(23-3)19(11-15)25-5/h7-14,21-22H,1-6H3/t13-,14-,21-,22+/m0/s1 |
| InChIKey | IPFNSBCMIQYCFA-GKHNXXNSSA-N |
| XLogP | 5.52 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.53 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |