C22H28O5 — CID 102108255
(1R,2S,3S,4R)-4-(3,4-dimethoxyphenyl)-6,7-dimethoxy-2,3-dimethyl-1,2,3,4-tetrahydronaphthalen-1-ol (PubChem CID 102108255) has the molecular formula C22H28O5 and a molecular weight of 372.46 g/mol. Its IUPAC name is (1R,2S,3S,4R)-4-(3,4-dimethoxyphenyl)-6,7-dimethoxy-2,3-dimethyl-1,2,3,4-tetrahydronaphthalen-1-ol.
| Compound Name | (1R,2S,3S,4R)-4-(3,4-dimethoxyphenyl)-6,7-dimethoxy-2,3-dimethyl-1,2,3,4-tetrahydronaphthalen-1-ol |
|---|---|
| PubChem CID | 102108255 |
| Molecular Formula | C22H28O5 |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | (1R,2S,3S,4R)-4-(3,4-dimethoxyphenyl)-6,7-dimethoxy-2,3-dimethyl-1,2,3,4-tetrahydronaphthalen-1-ol |
| SMILES | COc1ccc([C@@H]2c3cc(OC)c(OC)cc3[C@H](O)[C@@H](C)[C@H]2C)cc1OC |
| InChI | InChI=1S/C22H28O5/c1-12-13(2)22(23)16-11-20(27-6)19(26-5)10-15(16)21(12)14-7-8-17(24-3)18(9-14)25-4/h7-13,21-23H,1-6H3/t12-,13+,21-,22-/m1/s1 |
| InChIKey | WBRPUFHEMGUPKR-YQJHHNQMSA-N |
| XLogP | 4.17 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |