C20H23NO5 — CID 45480891
(NZ)-N-[3-(3,4-dimethoxyphenyl)-5,6-dimethoxy-2-methyl-2,3-dihydroinden-1-ylidene]hydroxylamine (PubChem CID 45480891) has the molecular formula C20H23NO5 and a molecular weight of 357.41 g/mol. Its IUPAC name is (NZ)-N-[3-(3,4-dimethoxyphenyl)-5,6-dimethoxy-2-methyl-2,3-dihydroinden-1-ylidene]hydroxylamine.
| Compound Name | (NZ)-N-[3-(3,4-dimethoxyphenyl)-5,6-dimethoxy-2-methyl-2,3-dihydroinden-1-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 45480891 |
| Molecular Formula | C20H23NO5 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | (NZ)-N-[3-(3,4-dimethoxyphenyl)-5,6-dimethoxy-2-methyl-2,3-dihydroinden-1-ylidene]hydroxylamine |
| SMILES | COc1ccc(C2c3cc(OC)c(OC)cc3/C(=N\O)C2C)cc1OC |
| InChI | InChI=1S/C20H23NO5/c1-11-19(12-6-7-15(23-2)16(8-12)24-3)13-9-17(25-4)18(26-5)10-14(13)20(11)21-22/h6-11,19,22H,1-5H3/b21-20- |
| InChIKey | IAWXBXIBZWWNHY-MRCUWXFGSA-N |
| XLogP | 3.68 |
| TPSA | 69.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|