C20H22O4 — CID 14024787
3-(3,4-dimethoxyphenyl)-5,6-dimethoxy-1-methyl-1H-indene (PubChem CID 14024787) has the molecular formula C20H22O4 and a molecular weight of 326.39 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-5,6-dimethoxy-1-methyl-1H-indene.
| Compound Name | 3-(3,4-dimethoxyphenyl)-5,6-dimethoxy-1-methyl-1H-indene |
|---|---|
| PubChem CID | 14024787 |
| Molecular Formula | C20H22O4 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-5,6-dimethoxy-1-methyl-1H-indene |
| SMILES | COc1ccc(C2=CC(C)c3cc(OC)c(OC)cc32)cc1OC |
| InChI | InChI=1S/C20H22O4/c1-12-8-15(13-6-7-17(21-2)18(9-13)22-3)16-11-20(24-5)19(23-4)10-14(12)16/h6-12H,1-5H3 |
| InChIKey | MBCIQTWETSCIGK-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |