C20H16F2O2 — CID 118497324
1,2-bis(4-fluorophenyl)-4,5-dimethoxybenzene (PubChem CID 118497324) has the molecular formula C20H16F2O2 and a molecular weight of 326.34 g/mol. Its IUPAC name is 1,2-bis(4-fluorophenyl)-4,5-dimethoxybenzene.
| Compound Name | 1,2-bis(4-fluorophenyl)-4,5-dimethoxybenzene |
|---|---|
| PubChem CID | 118497324 |
| Molecular Formula | C20H16F2O2 |
| Molecular Weight | 326.34 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | 1,2-bis(4-fluorophenyl)-4,5-dimethoxybenzene |
| SMILES | COc1cc(-c2ccc(F)cc2)c(-c2ccc(F)cc2)cc1OC |
| InChI | InChI=1S/C20H16F2O2/c1-23-19-11-17(13-3-7-15(21)8-4-13)18(12-20(19)24-2)14-5-9-16(22)10-6-14/h3-12H,1-2H3 |
| InChIKey | JMHBGSIZSZTCBM-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.34 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |