C18H14F2N2 — CID 135324537
4,5-bis(4-fluorophenyl)benzene-1,2-diamine (PubChem CID 135324537) has the molecular formula C18H14F2N2 and a molecular weight of 296.32 g/mol. Its IUPAC name is 4,5-bis(4-fluorophenyl)benzene-1,2-diamine.
| Compound Name | 4,5-bis(4-fluorophenyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 135324537 |
| Molecular Formula | C18H14F2N2 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | 4,5-bis(4-fluorophenyl)benzene-1,2-diamine |
| SMILES | Nc1cc(-c2ccc(F)cc2)c(-c2ccc(F)cc2)cc1N |
| InChI | InChI=1S/C18H14F2N2/c19-13-5-1-11(2-6-13)15-9-17(21)18(22)10-16(15)12-3-7-14(20)8-4-12/h1-10H,21-22H2 |
| InChIKey | GSLFCXQTFKHRGW-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|