C60H54N6O12 — CID 101071642
4,5,10,11,16,17-hexakis(3,4-dimethoxyphenyl)-3,6,9,12,15,18-hexazatetracyclo[12.4.0.02,7.08,13]octadeca-1,3,5,7,9,11,13,15,17-nonaene (PubChem CID 101071642) has the molecular formula C60H54N6O12 and a molecular weight of 1051.12 g/mol. Its IUPAC name is 4,5,10,11,16,17-hexakis(3,4-dimethoxyphenyl)-3,6,9,12,15,18-hexazatetracyclo[12.4.0.02,7.08,13]octadeca-1,3,5,7,9,11,13,15,17-nonaene.
| Compound Name | 4,5,10,11,16,17-hexakis(3,4-dimethoxyphenyl)-3,6,9,12,15,18-hexazatetracyclo[12.4.0.02,7.08,13]octadeca-1,3,5,7,9,11,13,15,17-nonaene |
|---|---|
| PubChem CID | 101071642 |
| Molecular Formula | C60H54N6O12 |
| Molecular Weight | 1051.12 g/mol |
| Exact Mass | 1050.38 |
| IUPAC Name | 4,5,10,11,16,17-hexakis(3,4-dimethoxyphenyl)-3,6,9,12,15,18-hexazatetracyclo[12.4.0.02,7.08,13]octadeca-1,3,5,7,9,11,13,15,17-nonaene |
| SMILES | COc1ccc(-c2nc3c4nc(-c5ccc(OC)c(OC)c5)c(-c5ccc(OC)c(OC)c5)nc4c4nc(-c5ccc(OC)c(OC)c5)c(-c5ccc(OC)c(OC)c5)nc4c3nc2-c2ccc(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C60H54N6O12/c1-67-37-19-13-31(25-43(37)73-7)49-50(32-14-20-38(68-2)44(26-32)74-8)62-56-55(61-49)57-59(65-52(34-16-22-40(70-4)46(28-34)76-10)51(63-57)33-15-21-39(69-3)45(27-33)75-9)60-58(56)64-53(35-17-23-41(71-5)47(29-35)77-11)54(66-60)36-18-24-42(72-6)48(30-36)78-12/h13-30H,1-12H3 |
| InChIKey | SHKSYHKZWONNHG-UHFFFAOYSA-N |
| XLogP | 11.62 |
| TPSA | 188.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 78 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1051.12 |
| LogP ≤ 5 | 11.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|