C20H19F3N2O4 — CID 154287281
4,5-bis(3,4-dimethoxyphenyl)-2-(trifluoromethyl)-1H-imidazole (PubChem CID 154287281) has the molecular formula C20H19F3N2O4 and a molecular weight of 408.38 g/mol. Its IUPAC name is 4,5-bis(3,4-dimethoxyphenyl)-2-(trifluoromethyl)-1H-imidazole.
| Compound Name | 4,5-bis(3,4-dimethoxyphenyl)-2-(trifluoromethyl)-1H-imidazole |
|---|---|
| PubChem CID | 154287281 |
| Molecular Formula | C20H19F3N2O4 |
| Molecular Weight | 408.38 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | 4,5-bis(3,4-dimethoxyphenyl)-2-(trifluoromethyl)-1H-imidazole |
| SMILES | COc1ccc(-c2nc(C(F)(F)F)[nH]c2-c2ccc(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C20H19F3N2O4/c1-26-13-7-5-11(9-15(13)28-3)17-18(25-19(24-17)20(21,22)23)12-6-8-14(27-2)16(10-12)29-4/h5-10H,1-4H3,(H,24,25) |
| InChIKey | WNQWZYPGHNBMLA-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 65.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.38 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |