C20H19F3N2O2 — CID 154311787
4,5-bis(4-ethoxyphenyl)-2-(trifluoromethyl)-1H-imidazole (PubChem CID 154311787) has the molecular formula C20H19F3N2O2 and a molecular weight of 376.38 g/mol. Its IUPAC name is 4,5-bis(4-ethoxyphenyl)-2-(trifluoromethyl)-1H-imidazole.
| Compound Name | 4,5-bis(4-ethoxyphenyl)-2-(trifluoromethyl)-1H-imidazole |
|---|---|
| PubChem CID | 154311787 |
| Molecular Formula | C20H19F3N2O2 |
| Molecular Weight | 376.38 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | 4,5-bis(4-ethoxyphenyl)-2-(trifluoromethyl)-1H-imidazole |
| SMILES | CCOc1ccc(-c2nc(C(F)(F)F)[nH]c2-c2ccc(OCC)cc2)cc1 |
| InChI | InChI=1S/C20H19F3N2O2/c1-3-26-15-9-5-13(6-10-15)17-18(25-19(24-17)20(21,22)23)14-7-11-16(12-8-14)27-4-2/h5-12H,3-4H2,1-2H3,(H,24,25) |
| InChIKey | VZWHCXRZACVODJ-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.38 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |