C19H17F3N2O3 — CID 13127265
1-[4,5-bis(4-methoxyphenyl)-1H-imidazol-2-yl]-2,2,2-trifluoroethanol (PubChem CID 13127265) has the molecular formula C19H17F3N2O3 and a molecular weight of 378.35 g/mol. Its IUPAC name is 1-[4,5-bis(4-methoxyphenyl)-1H-imidazol-2-yl]-2,2,2-trifluoroethanol.
| Compound Name | 1-[4,5-bis(4-methoxyphenyl)-1H-imidazol-2-yl]-2,2,2-trifluoroethanol |
|---|---|
| PubChem CID | 13127265 |
| Molecular Formula | C19H17F3N2O3 |
| Molecular Weight | 378.35 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | 1-[4,5-bis(4-methoxyphenyl)-1H-imidazol-2-yl]-2,2,2-trifluoroethanol |
| SMILES | COc1ccc(-c2nc(C(O)C(F)(F)F)[nH]c2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C19H17F3N2O3/c1-26-13-7-3-11(4-8-13)15-16(12-5-9-14(27-2)10-6-12)24-18(23-15)17(25)19(20,21)22/h3-10,17,25H,1-2H3,(H,23,24) |
| InChIKey | HPPRBRYZDDRMKD-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 67.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.35 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |