C36H30F6N4O4 — CID 90189417
4,5-bis(4-methoxyphenyl)-2-(trifluoromethyl)-1H-imidazole (PubChem CID 90189417) has the molecular formula C36H30F6N4O4 and a molecular weight of 696.65 g/mol. Its IUPAC name is 4,5-bis(4-methoxyphenyl)-2-(trifluoromethyl)-1H-imidazole.
| Compound Name | 4,5-bis(4-methoxyphenyl)-2-(trifluoromethyl)-1H-imidazole |
|---|---|
| PubChem CID | 90189417 |
| Molecular Formula | C36H30F6N4O4 |
| Molecular Weight | 696.65 g/mol |
| Exact Mass | 696.22 |
| IUPAC Name | 4,5-bis(4-methoxyphenyl)-2-(trifluoromethyl)-1H-imidazole |
| SMILES | COc1ccc(-c2nc(C(F)(F)F)[nH]c2-c2ccc(OC)cc2)cc1.COc1ccc(-c2nc(C(F)(F)F)[nH]c2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/2C18H15F3N2O2/c2*1-24-13-7-3-11(4-8-13)15-16(23-17(22-15)18(19,20)21)12-5-9-14(25-2)10-6-12/h2*3-10H,1-2H3,(H,22,23) |
| InChIKey | URSPUSHWQLNNFY-UHFFFAOYSA-N |
| XLogP | 9.56 |
| TPSA | 94.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.65 |
| LogP ≤ 5 | 9.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |