C18H15F3N2OS — CID 162576486
5-(4-methylphenyl)-4-(4-methylsulfinylphenyl)-2-(trifluoromethyl)-1H-imidazole (PubChem CID 162576486) has the molecular formula C18H15F3N2OS and a molecular weight of 364.39 g/mol. Its IUPAC name is 5-(4-methylphenyl)-4-(4-methylsulfinylphenyl)-2-(trifluoromethyl)-1H-imidazole.
| Compound Name | 5-(4-methylphenyl)-4-(4-methylsulfinylphenyl)-2-(trifluoromethyl)-1H-imidazole |
|---|---|
| PubChem CID | 162576486 |
| Molecular Formula | C18H15F3N2OS |
| Molecular Weight | 364.39 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | 5-(4-methylphenyl)-4-(4-methylsulfinylphenyl)-2-(trifluoromethyl)-1H-imidazole |
| SMILES | Cc1ccc(-c2[nH]c(C(F)(F)F)nc2-c2ccc(S(C)=O)cc2)cc1 |
| InChI | InChI=1S/C18H15F3N2OS/c1-11-3-5-12(6-4-11)15-16(23-17(22-15)18(19,20)21)13-7-9-14(10-8-13)25(2)24/h3-10H,1-2H3,(H,22,23) |
| InChIKey | DJFPBDQDUZTPBG-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.39 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |