C20H14F6N2O2 — CID 15369983
3,6-bis(4-methoxyphenyl)-4,5-bis(trifluoromethyl)pyridazine (PubChem CID 15369983) has the molecular formula C20H14F6N2O2 and a molecular weight of 428.33 g/mol. Its IUPAC name is 3,6-bis(4-methoxyphenyl)-4,5-bis(trifluoromethyl)pyridazine.
| Compound Name | 3,6-bis(4-methoxyphenyl)-4,5-bis(trifluoromethyl)pyridazine |
|---|---|
| PubChem CID | 15369983 |
| Molecular Formula | C20H14F6N2O2 |
| Molecular Weight | 428.33 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | 3,6-bis(4-methoxyphenyl)-4,5-bis(trifluoromethyl)pyridazine |
| SMILES | COc1ccc(-c2nnc(-c3ccc(OC)cc3)c(C(F)(F)F)c2C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H14F6N2O2/c1-29-13-7-3-11(4-8-13)17-15(19(21,22)23)16(20(24,25)26)18(28-27-17)12-5-9-14(30-2)10-6-12/h3-10H,1-2H3 |
| InChIKey | NUHGOGDZACOWOX-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.33 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |