C20H14F6N2 — CID 15369982
3,6-bis(4-methylphenyl)-4,5-bis(trifluoromethyl)pyridazine (PubChem CID 15369982) has the molecular formula C20H14F6N2 and a molecular weight of 396.33 g/mol. Its IUPAC name is 3,6-bis(4-methylphenyl)-4,5-bis(trifluoromethyl)pyridazine.
| Compound Name | 3,6-bis(4-methylphenyl)-4,5-bis(trifluoromethyl)pyridazine |
|---|---|
| PubChem CID | 15369982 |
| Molecular Formula | C20H14F6N2 |
| Molecular Weight | 396.33 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | 3,6-bis(4-methylphenyl)-4,5-bis(trifluoromethyl)pyridazine |
| SMILES | Cc1ccc(-c2nnc(-c3ccc(C)cc3)c(C(F)(F)F)c2C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H14F6N2/c1-11-3-7-13(8-4-11)17-15(19(21,22)23)16(20(24,25)26)18(28-27-17)14-9-5-12(2)6-10-14/h3-10H,1-2H3 |
| InChIKey | GQKJFBLRWZIAKS-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.33 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |