C19H13F9N2O2 — CID 16744383
(Z)-3-amino-1-[6-fluoro-2-(4-methoxyphenyl)-4-(1,1,2,2,2-pentafluoroethyl)-5-(trifluoromethyl)-3-pyridinyl]but-2-en-1-one (PubChem CID 16744383) has the molecular formula C19H13F9N2O2 and a molecular weight of 472.31 g/mol. Its IUPAC name is (Z)-3-amino-1-[6-fluoro-2-(4-methoxyphenyl)-4-(1,1,2,2,2-pentafluoroethyl)-5-(trifluoromethyl)-3-pyridinyl]but-2-en-1-one.
| Compound Name | (Z)-3-amino-1-[6-fluoro-2-(4-methoxyphenyl)-4-(1,1,2,2,2-pentafluoroethyl)-5-(trifluoromethyl)-3-pyridinyl]but-2-en-1-one |
|---|---|
| PubChem CID | 16744383 |
| Molecular Formula | C19H13F9N2O2 |
| Molecular Weight | 472.31 g/mol |
| Exact Mass | 472.08 |
| IUPAC Name | (Z)-3-amino-1-[6-fluoro-2-(4-methoxyphenyl)-4-(1,1,2,2,2-pentafluoroethyl)-5-(trifluoromethyl)-3-pyridinyl]but-2-en-1-one |
| SMILES | COc1ccc(-c2nc(F)c(C(F)(F)F)c(C(F)(F)C(F)(F)F)c2C(=O)/C=C(/C)N)cc1 |
| InChI | InChI=1S/C19H13F9N2O2/c1-8(29)7-11(31)12-13(17(21,22)19(26,27)28)14(18(23,24)25)16(20)30-15(12)9-3-5-10(32-2)6-4-9/h3-7H,29H2,1-2H3/b8-7- |
| InChIKey | QDUXNXFWJRVIFS-FPLPWBNLSA-N |
| XLogP | 5.61 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.31 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|