C10H10N4O — CID 116822966
6-(4-methoxyphenyl)-1,2,4-triazin-5-amine (PubChem CID 116822966) has the molecular formula C10H10N4O and a molecular weight of 202.22 g/mol. Its IUPAC name is 6-(4-methoxyphenyl)-1,2,4-triazin-5-amine.
| Compound Name | 6-(4-methoxyphenyl)-1,2,4-triazin-5-amine |
|---|---|
| PubChem CID | 116822966 |
| Molecular Formula | C10H10N4O |
| Molecular Weight | 202.22 g/mol |
| Exact Mass | 202.09 |
| IUPAC Name | 6-(4-methoxyphenyl)-1,2,4-triazin-5-amine |
| SMILES | COc1ccc(-c2nncnc2N)cc1 |
| InChI | InChI=1S/C10H10N4O/c1-15-8-4-2-7(3-5-8)9-10(11)12-6-13-14-9/h2-6H,1H3,(H2,11,12,13) |
| InChIKey | FKZTXGSAOUWOBZ-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 73.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.22 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |