C11H12N4 — CID 116822961
6-(3,4-dimethylphenyl)-1,2,4-triazin-5-amine (PubChem CID 116822961) has the molecular formula C11H12N4 and a molecular weight of 200.24 g/mol. Its IUPAC name is 6-(3,4-dimethylphenyl)-1,2,4-triazin-5-amine.
| Compound Name | 6-(3,4-dimethylphenyl)-1,2,4-triazin-5-amine |
|---|---|
| PubChem CID | 116822961 |
| Molecular Formula | C11H12N4 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.11 |
| IUPAC Name | 6-(3,4-dimethylphenyl)-1,2,4-triazin-5-amine |
| SMILES | Cc1ccc(-c2nncnc2N)cc1C |
| InChI | InChI=1S/C11H12N4/c1-7-3-4-9(5-8(7)2)10-11(12)13-6-14-15-10/h3-6H,1-2H3,(H2,12,13,14) |
| InChIKey | KDYBDTIFVUKGJJ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |