C9H7FN4 — CID 116822964
6-(4-fluorophenyl)-1,2,4-triazin-5-amine (PubChem CID 116822964) has the molecular formula C9H7FN4 and a molecular weight of 190.18 g/mol. Its IUPAC name is 6-(4-fluorophenyl)-1,2,4-triazin-5-amine.
| Compound Name | 6-(4-fluorophenyl)-1,2,4-triazin-5-amine |
|---|---|
| PubChem CID | 116822964 |
| Molecular Formula | C9H7FN4 |
| Molecular Weight | 190.18 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | 6-(4-fluorophenyl)-1,2,4-triazin-5-amine |
| SMILES | Nc1ncnnc1-c1ccc(F)cc1 |
| InChI | InChI=1S/C9H7FN4/c10-7-3-1-6(2-4-7)8-9(11)12-5-13-14-8/h1-5H,(H2,11,12,13) |
| InChIKey | YNFOYECJEFVWJX-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.18 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |