C10H9FN4 — CID 116823124
6-(4-fluorophenyl)-N-methyl-1,2,4-triazin-5-amine (PubChem CID 116823124) has the molecular formula C10H9FN4 and a molecular weight of 204.21 g/mol. Its IUPAC name is 6-(4-fluorophenyl)-N-methyl-1,2,4-triazin-5-amine.
| Compound Name | 6-(4-fluorophenyl)-N-methyl-1,2,4-triazin-5-amine |
|---|---|
| PubChem CID | 116823124 |
| Molecular Formula | C10H9FN4 |
| Molecular Weight | 204.21 g/mol |
| Exact Mass | 204.08 |
| IUPAC Name | 6-(4-fluorophenyl)-N-methyl-1,2,4-triazin-5-amine |
| SMILES | CNc1ncnnc1-c1ccc(F)cc1 |
| InChI | InChI=1S/C10H9FN4/c1-12-10-9(15-14-6-13-10)7-2-4-8(11)5-3-7/h2-6H,1H3,(H,12,13,14) |
| InChIKey | HKPJUBGUCJVEOK-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.21 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |