C11H10N6 — CID 116823205
6-(3H-benzimidazol-5-yl)-N-methyl-1,2,4-triazin-5-amine (PubChem CID 116823205) has the molecular formula C11H10N6 and a molecular weight of 226.24 g/mol. Its IUPAC name is 6-(3H-benzimidazol-5-yl)-N-methyl-1,2,4-triazin-5-amine.
| Compound Name | 6-(3H-benzimidazol-5-yl)-N-methyl-1,2,4-triazin-5-amine |
|---|---|
| PubChem CID | 116823205 |
| Molecular Formula | C11H10N6 |
| Molecular Weight | 226.24 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 6-(3H-benzimidazol-5-yl)-N-methyl-1,2,4-triazin-5-amine |
| SMILES | CNc1ncnnc1-c1ccc2nc[nH]c2c1 |
| InChI | InChI=1S/C11H10N6/c1-12-11-10(17-16-6-15-11)7-2-3-8-9(4-7)14-5-13-8/h2-6H,1H3,(H,13,14)(H,12,15,16) |
| InChIKey | ICRKXHSAOIVQFZ-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.24 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |