About N-methyl-6-(1H-pyrrol-2-yl)-1,2,4-triazin-5-amine
N-methyl-6-(1H-pyrrol-2-yl)-1,2,4-triazin-5-amine (PubChem CID 116823177) has the molecular formula C8H9N5
and a molecular weight of 175.19 g/mol. Its IUPAC name is N-methyl-6-(1H-pyrrol-2-yl)-1,2,4-triazin-5-amine.
Molecular Properties
| Compound Name | N-methyl-6-(1H-pyrrol-2-yl)-1,2,4-triazin-5-amine |
| PubChem CID | 116823177 |
| Molecular Formula | C8H9N5 |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.09 |
| IUPAC Name | N-methyl-6-(1H-pyrrol-2-yl)-1,2,4-triazin-5-amine |
| SMILES | CNc1ncnnc1-c1ccc[nH]1 |
| InChI | InChI=1S/C8H9N5/c1-9-8-7(13-12-5-11-8)6-3-2-4-10-6/h2-5,10H,1H3,(H,9,11,12) |
| InChIKey | AYVGUYKHKROFBJ-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-methyl-6-(1H-pyrrol-2-yl)-1,2,4-triazin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-6-(1H-pyrrol-2-yl)-1,2,4-triazin-5-amine?
The IUPAC name of N-methyl-6-(1H-pyrrol-2-yl)-1,2,4-triazin-5-amine (CID 116823177) is N-methyl-6-(1H-pyrrol-2-yl)-1,2,4-triazin-5-amine.
What is the SMILES notation for N-methyl-6-(1H-pyrrol-2-yl)-1,2,4-triazin-5-amine?
The canonical SMILES for N-methyl-6-(1H-pyrrol-2-yl)-1,2,4-triazin-5-amine is CNc1ncnnc1-c1ccc[nH]1.
What is the InChIKey of N-methyl-6-(1H-pyrrol-2-yl)-1,2,4-triazin-5-amine?
The InChIKey is AYVGUYKHKROFBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N5/c1-9-8-7(13-12-5-11-8)6-3-2-4-10-6/h2-5,10H,1H3,(H,9,11,12).
What are the key properties of N-methyl-6-(1H-pyrrol-2-yl)-1,2,4-triazin-5-amine?
N-methyl-6-(1H-pyrrol-2-yl)-1,2,4-triazin-5-amine has a molecular weight of 175.19 g/mol, XLogP of 0.91, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-6-(1H-pyrrol-2-yl)-1,2,4-triazin-5-amine is sourced from PubChem (CID 116823177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).