C8H9N5 — CID 116823177
N-methyl-6-(1H-pyrrol-2-yl)-1,2,4-triazin-5-amine (PubChem CID 116823177) has the molecular formula C8H9N5 and a molecular weight of 175.19 g/mol. Its IUPAC name is N-methyl-6-(1H-pyrrol-2-yl)-1,2,4-triazin-5-amine.
| Compound Name | N-methyl-6-(1H-pyrrol-2-yl)-1,2,4-triazin-5-amine |
|---|---|
| PubChem CID | 116823177 |
| Molecular Formula | C8H9N5 |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.09 |
| IUPAC Name | N-methyl-6-(1H-pyrrol-2-yl)-1,2,4-triazin-5-amine |
| SMILES | CNc1ncnnc1-c1ccc[nH]1 |
| InChI | InChI=1S/C8H9N5/c1-9-8-7(13-12-5-11-8)6-3-2-4-10-6/h2-5,10H,1H3,(H,9,11,12) |
| InChIKey | AYVGUYKHKROFBJ-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |