C10H8F2N4 — CID 116823159
6-(3,4-difluorophenyl)-N-methyl-1,2,4-triazin-5-amine (PubChem CID 116823159) has the molecular formula C10H8F2N4 and a molecular weight of 222.20 g/mol. Its IUPAC name is 6-(3,4-difluorophenyl)-N-methyl-1,2,4-triazin-5-amine.
| Compound Name | 6-(3,4-difluorophenyl)-N-methyl-1,2,4-triazin-5-amine |
|---|---|
| PubChem CID | 116823159 |
| Molecular Formula | C10H8F2N4 |
| Molecular Weight | 222.20 g/mol |
| Exact Mass | 222.07 |
| IUPAC Name | 6-(3,4-difluorophenyl)-N-methyl-1,2,4-triazin-5-amine |
| SMILES | CNc1ncnnc1-c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C10H8F2N4/c1-13-10-9(16-15-5-14-10)6-2-3-7(11)8(12)4-6/h2-5H,1H3,(H,13,14,15) |
| InChIKey | UTUFZELNVIWHLV-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.20 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |