C12H10F2IN3 — CID 66304716
2-(3,4-difluorophenyl)-5-iodo-N,6-dimethylpyrimidin-4-amine (PubChem CID 66304716) has the molecular formula C12H10F2IN3 and a molecular weight of 361.13 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)-5-iodo-N,6-dimethylpyrimidin-4-amine.
| Compound Name | 2-(3,4-difluorophenyl)-5-iodo-N,6-dimethylpyrimidin-4-amine |
|---|---|
| PubChem CID | 66304716 |
| Molecular Formula | C12H10F2IN3 |
| Molecular Weight | 361.13 g/mol |
| Exact Mass | 360.99 |
| IUPAC Name | 2-(3,4-difluorophenyl)-5-iodo-N,6-dimethylpyrimidin-4-amine |
| SMILES | CNc1nc(-c2ccc(F)c(F)c2)nc(C)c1I |
| InChI | InChI=1S/C12H10F2IN3/c1-6-10(15)12(16-2)18-11(17-6)7-3-4-8(13)9(14)5-7/h3-5H,1-2H3,(H,16,17,18) |
| InChIKey | SHXDJYYDEMJYMD-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.13 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|