C14H16IN3 — CID 66295351
2-(2,5-dimethylphenyl)-5-iodo-N,6-dimethylpyrimidin-4-amine (PubChem CID 66295351) has the molecular formula C14H16IN3 and a molecular weight of 353.21 g/mol. Its IUPAC name is 2-(2,5-dimethylphenyl)-5-iodo-N,6-dimethylpyrimidin-4-amine.
| Compound Name | 2-(2,5-dimethylphenyl)-5-iodo-N,6-dimethylpyrimidin-4-amine |
|---|---|
| PubChem CID | 66295351 |
| Molecular Formula | C14H16IN3 |
| Molecular Weight | 353.21 g/mol |
| Exact Mass | 353.04 |
| IUPAC Name | 2-(2,5-dimethylphenyl)-5-iodo-N,6-dimethylpyrimidin-4-amine |
| SMILES | CNc1nc(-c2cc(C)ccc2C)nc(C)c1I |
| InChI | InChI=1S/C14H16IN3/c1-8-5-6-9(2)11(7-8)13-17-10(3)12(15)14(16-4)18-13/h5-7H,1-4H3,(H,16,17,18) |
| InChIKey | XRGBKLASZQZTND-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.21 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|