C15H13IN4 — CID 66297086
5-iodo-N,6-dimethyl-2-quinolin-4-ylpyrimidin-4-amine (PubChem CID 66297086) has the molecular formula C15H13IN4 and a molecular weight of 376.20 g/mol. Its IUPAC name is 5-iodo-N,6-dimethyl-2-quinolin-4-ylpyrimidin-4-amine.
| Compound Name | 5-iodo-N,6-dimethyl-2-quinolin-4-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 66297086 |
| Molecular Formula | C15H13IN4 |
| Molecular Weight | 376.20 g/mol |
| Exact Mass | 376.02 |
| IUPAC Name | 5-iodo-N,6-dimethyl-2-quinolin-4-ylpyrimidin-4-amine |
| SMILES | CNc1nc(-c2ccnc3ccccc23)nc(C)c1I |
| InChI | InChI=1S/C15H13IN4/c1-9-13(16)15(17-2)20-14(19-9)11-7-8-18-12-6-4-3-5-10(11)12/h3-8H,1-2H3,(H,17,19,20) |
| InChIKey | OCNDETZJFMTRFQ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.20 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|