C13H11F3IN3 — CID 66295542
5-iodo-N,6-dimethyl-2-[2-(trifluoromethyl)phenyl]pyrimidin-4-amine (PubChem CID 66295542) has the molecular formula C13H11F3IN3 and a molecular weight of 393.15 g/mol. Its IUPAC name is 5-iodo-N,6-dimethyl-2-[2-(trifluoromethyl)phenyl]pyrimidin-4-amine.
| Compound Name | 5-iodo-N,6-dimethyl-2-[2-(trifluoromethyl)phenyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 66295542 |
| Molecular Formula | C13H11F3IN3 |
| Molecular Weight | 393.15 g/mol |
| Exact Mass | 392.99 |
| IUPAC Name | 5-iodo-N,6-dimethyl-2-[2-(trifluoromethyl)phenyl]pyrimidin-4-amine |
| SMILES | CNc1nc(-c2ccccc2C(F)(F)F)nc(C)c1I |
| InChI | InChI=1S/C13H11F3IN3/c1-7-10(17)12(18-2)20-11(19-7)8-5-3-4-6-9(8)13(14,15)16/h3-6H,1-2H3,(H,18,19,20) |
| InChIKey | XCNVTQPKYONRNP-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.15 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|