About 5-iodo-N,6-dimethyl-2-[2-(trifluoromethyl)phenyl]pyrimidin-4-amine
5-iodo-N,6-dimethyl-2-[2-(trifluoromethyl)phenyl]pyrimidin-4-amine (PubChem CID 66295542) has the molecular formula C13H11F3IN3
and a molecular weight of 393.15 g/mol. Its IUPAC name is 5-iodo-N,6-dimethyl-2-[2-(trifluoromethyl)phenyl]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 5-iodo-N,6-dimethyl-2-[2-(trifluoromethyl)phenyl]pyrimidin-4-amine |
| PubChem CID | 66295542 |
| Molecular Formula | C13H11F3IN3 |
| Molecular Weight | 393.15 g/mol |
| Exact Mass | 392.99 |
| IUPAC Name | 5-iodo-N,6-dimethyl-2-[2-(trifluoromethyl)phenyl]pyrimidin-4-amine |
| SMILES | CNc1nc(-c2ccccc2C(F)(F)F)nc(C)c1I |
| InChI | InChI=1S/C13H11F3IN3/c1-7-10(17)12(18-2)20-11(19-7)8-5-3-4-6-9(8)13(14,15)16/h3-6H,1-2H3,(H,18,19,20) |
| InChIKey | XCNVTQPKYONRNP-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.15 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-iodo-N,6-dimethyl-2-[2-(trifluoromethyl)phenyl]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-iodo-N,6-dimethyl-2-[2-(trifluoromethyl)phenyl]pyrimidin-4-amine?
The IUPAC name of 5-iodo-N,6-dimethyl-2-[2-(trifluoromethyl)phenyl]pyrimidin-4-amine (CID 66295542) is 5-iodo-N,6-dimethyl-2-[2-(trifluoromethyl)phenyl]pyrimidin-4-amine.
What is the SMILES notation for 5-iodo-N,6-dimethyl-2-[2-(trifluoromethyl)phenyl]pyrimidin-4-amine?
The canonical SMILES for 5-iodo-N,6-dimethyl-2-[2-(trifluoromethyl)phenyl]pyrimidin-4-amine is CNc1nc(-c2ccccc2C(F)(F)F)nc(C)c1I.
What is the InChIKey of 5-iodo-N,6-dimethyl-2-[2-(trifluoromethyl)phenyl]pyrimidin-4-amine?
The InChIKey is XCNVTQPKYONRNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11F3IN3/c1-7-10(17)12(18-2)20-11(19-7)8-5-3-4-6-9(8)13(14,15)16/h3-6H,1-2H3,(H,18,19,20).
What are the key properties of 5-iodo-N,6-dimethyl-2-[2-(trifluoromethyl)phenyl]pyrimidin-4-amine?
5-iodo-N,6-dimethyl-2-[2-(trifluoromethyl)phenyl]pyrimidin-4-amine has a molecular weight of 393.15 g/mol, XLogP of 4.12, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-iodo-N,6-dimethyl-2-[2-(trifluoromethyl)phenyl]pyrimidin-4-amine is sourced from PubChem (CID 66295542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).