C12H14IN3S — CID 66296123
2-(2,5-dimethylthiophen-3-yl)-5-iodo-N,6-dimethylpyrimidin-4-amine (PubChem CID 66296123) has the molecular formula C12H14IN3S and a molecular weight of 359.24 g/mol. Its IUPAC name is 2-(2,5-dimethylthiophen-3-yl)-5-iodo-N,6-dimethylpyrimidin-4-amine.
| Compound Name | 2-(2,5-dimethylthiophen-3-yl)-5-iodo-N,6-dimethylpyrimidin-4-amine |
|---|---|
| PubChem CID | 66296123 |
| Molecular Formula | C12H14IN3S |
| Molecular Weight | 359.24 g/mol |
| Exact Mass | 359.00 |
| IUPAC Name | 2-(2,5-dimethylthiophen-3-yl)-5-iodo-N,6-dimethylpyrimidin-4-amine |
| SMILES | CNc1nc(-c2cc(C)sc2C)nc(C)c1I |
| InChI | InChI=1S/C12H14IN3S/c1-6-5-9(8(3)17-6)11-15-7(2)10(13)12(14-4)16-11/h5H,1-4H3,(H,14,15,16) |
| InChIKey | ULIVXDFRZPGBIK-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.24 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|