C10H9BrIN3S — CID 66306503
2-(4-bromothiophen-2-yl)-5-iodo-N,6-dimethylpyrimidin-4-amine (PubChem CID 66306503) has the molecular formula C10H9BrIN3S and a molecular weight of 410.08 g/mol. Its IUPAC name is 2-(4-bromothiophen-2-yl)-5-iodo-N,6-dimethylpyrimidin-4-amine.
| Compound Name | 2-(4-bromothiophen-2-yl)-5-iodo-N,6-dimethylpyrimidin-4-amine |
|---|---|
| PubChem CID | 66306503 |
| Molecular Formula | C10H9BrIN3S |
| Molecular Weight | 410.08 g/mol |
| Exact Mass | 408.87 |
| IUPAC Name | 2-(4-bromothiophen-2-yl)-5-iodo-N,6-dimethylpyrimidin-4-amine |
| SMILES | CNc1nc(-c2cc(Br)cs2)nc(C)c1I |
| InChI | InChI=1S/C10H9BrIN3S/c1-5-8(12)10(13-2)15-9(14-5)7-3-6(11)4-16-7/h3-4H,1-2H3,(H,13,14,15) |
| InChIKey | NXAFYEXNKAPSQH-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.08 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|