C15H20BrN3S — CID 63480516
2-(4-bromothiophen-2-yl)-6-methyl-5-propan-2-yl-N-propylpyrimidin-4-amine (PubChem CID 63480516) has the molecular formula C15H20BrN3S and a molecular weight of 354.32 g/mol. Its IUPAC name is 2-(4-bromothiophen-2-yl)-6-methyl-5-propan-2-yl-N-propylpyrimidin-4-amine.
| Compound Name | 2-(4-bromothiophen-2-yl)-6-methyl-5-propan-2-yl-N-propylpyrimidin-4-amine |
|---|---|
| PubChem CID | 63480516 |
| Molecular Formula | C15H20BrN3S |
| Molecular Weight | 354.32 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | 2-(4-bromothiophen-2-yl)-6-methyl-5-propan-2-yl-N-propylpyrimidin-4-amine |
| SMILES | CCCNc1nc(-c2cc(Br)cs2)nc(C)c1C(C)C |
| InChI | InChI=1S/C15H20BrN3S/c1-5-6-17-15-13(9(2)3)10(4)18-14(19-15)12-7-11(16)8-20-12/h7-9H,5-6H2,1-4H3,(H,17,18,19) |
| InChIKey | SCMRYPOLQDQRKO-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.32 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |