C13H15BrIN3OS — CID 66301815
2-(4-bromothiophen-2-yl)-5-iodo-6-(methoxymethyl)-N-propylpyrimidin-4-amine (PubChem CID 66301815) has the molecular formula C13H15BrIN3OS and a molecular weight of 468.16 g/mol. Its IUPAC name is 2-(4-bromothiophen-2-yl)-5-iodo-6-(methoxymethyl)-N-propylpyrimidin-4-amine.
| Compound Name | 2-(4-bromothiophen-2-yl)-5-iodo-6-(methoxymethyl)-N-propylpyrimidin-4-amine |
|---|---|
| PubChem CID | 66301815 |
| Molecular Formula | C13H15BrIN3OS |
| Molecular Weight | 468.16 g/mol |
| Exact Mass | 466.92 |
| IUPAC Name | 2-(4-bromothiophen-2-yl)-5-iodo-6-(methoxymethyl)-N-propylpyrimidin-4-amine |
| SMILES | CCCNc1nc(-c2cc(Br)cs2)nc(COC)c1I |
| InChI | InChI=1S/C13H15BrIN3OS/c1-3-4-16-13-11(15)9(6-19-2)17-12(18-13)10-5-8(14)7-20-10/h5,7H,3-4,6H2,1-2H3,(H,16,17,18) |
| InChIKey | GWHYAKGFXGLSOX-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.16 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|