C12H12Br2IN3OS — CID 102844049
2-(4,5-dibromothiophen-2-yl)-N-ethyl-5-iodo-6-(methoxymethyl)pyrimidin-4-amine (PubChem CID 102844049) has the molecular formula C12H12Br2IN3OS and a molecular weight of 533.03 g/mol. Its IUPAC name is 2-(4,5-dibromothiophen-2-yl)-N-ethyl-5-iodo-6-(methoxymethyl)pyrimidin-4-amine.
| Compound Name | 2-(4,5-dibromothiophen-2-yl)-N-ethyl-5-iodo-6-(methoxymethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 102844049 |
| Molecular Formula | C12H12Br2IN3OS |
| Molecular Weight | 533.03 g/mol |
| Exact Mass | 530.81 |
| IUPAC Name | 2-(4,5-dibromothiophen-2-yl)-N-ethyl-5-iodo-6-(methoxymethyl)pyrimidin-4-amine |
| SMILES | CCNc1nc(-c2cc(Br)c(Br)s2)nc(COC)c1I |
| InChI | InChI=1S/C12H12Br2IN3OS/c1-3-16-12-9(15)7(5-19-2)17-11(18-12)8-4-6(13)10(14)20-8/h4H,3,5H2,1-2H3,(H,16,17,18) |
| InChIKey | DWDQYMLVMCSZMQ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.03 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|