C11H12ClIN4OS — CID 107125369
2-(5-chloro-1,3-thiazol-2-yl)-N-ethyl-5-iodo-6-(methoxymethyl)pyrimidin-4-amine (PubChem CID 107125369) has the molecular formula C11H12ClIN4OS and a molecular weight of 410.67 g/mol. Its IUPAC name is 2-(5-chloro-1,3-thiazol-2-yl)-N-ethyl-5-iodo-6-(methoxymethyl)pyrimidin-4-amine.
| Compound Name | 2-(5-chloro-1,3-thiazol-2-yl)-N-ethyl-5-iodo-6-(methoxymethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 107125369 |
| Molecular Formula | C11H12ClIN4OS |
| Molecular Weight | 410.67 g/mol |
| Exact Mass | 409.95 |
| IUPAC Name | 2-(5-chloro-1,3-thiazol-2-yl)-N-ethyl-5-iodo-6-(methoxymethyl)pyrimidin-4-amine |
| SMILES | CCNc1nc(-c2ncc(Cl)s2)nc(COC)c1I |
| InChI | InChI=1S/C11H12ClIN4OS/c1-3-14-9-8(13)6(5-18-2)16-10(17-9)11-15-4-7(12)19-11/h4H,3,5H2,1-2H3,(H,14,16,17) |
| InChIKey | WAPPJLUAJGQISU-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.67 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|