C10H10ClIN4S — CID 107125357
2-(5-chloro-1,3-thiazol-2-yl)-6-ethyl-5-iodo-N-methylpyrimidin-4-amine (PubChem CID 107125357) has the molecular formula C10H10ClIN4S and a molecular weight of 380.64 g/mol. Its IUPAC name is 2-(5-chloro-1,3-thiazol-2-yl)-6-ethyl-5-iodo-N-methylpyrimidin-4-amine.
| Compound Name | 2-(5-chloro-1,3-thiazol-2-yl)-6-ethyl-5-iodo-N-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 107125357 |
| Molecular Formula | C10H10ClIN4S |
| Molecular Weight | 380.64 g/mol |
| Exact Mass | 379.94 |
| IUPAC Name | 2-(5-chloro-1,3-thiazol-2-yl)-6-ethyl-5-iodo-N-methylpyrimidin-4-amine |
| SMILES | CCc1nc(-c2ncc(Cl)s2)nc(NC)c1I |
| InChI | InChI=1S/C10H10ClIN4S/c1-3-5-7(12)8(13-2)16-9(15-5)10-14-4-6(11)17-10/h4H,3H2,1-2H3,(H,13,15,16) |
| InChIKey | QUIJCDFFLCLZPD-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.64 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|