C9H10ClN5OS — CID 107125441
[2-(5-chloro-1,3-thiazol-2-yl)-6-(methoxymethyl)pyrimidin-4-yl]hydrazine (PubChem CID 107125441) has the molecular formula C9H10ClN5OS and a molecular weight of 271.73 g/mol. Its IUPAC name is [2-(5-chloro-1,3-thiazol-2-yl)-6-(methoxymethyl)pyrimidin-4-yl]hydrazine.
| Compound Name | [2-(5-chloro-1,3-thiazol-2-yl)-6-(methoxymethyl)pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 107125441 |
| Molecular Formula | C9H10ClN5OS |
| Molecular Weight | 271.73 g/mol |
| Exact Mass | 271.03 |
| IUPAC Name | [2-(5-chloro-1,3-thiazol-2-yl)-6-(methoxymethyl)pyrimidin-4-yl]hydrazine |
| SMILES | COCc1cc(NN)nc(-c2ncc(Cl)s2)n1 |
| InChI | InChI=1S/C9H10ClN5OS/c1-16-4-5-2-7(15-11)14-8(13-5)9-12-3-6(10)17-9/h2-3H,4,11H2,1H3,(H,13,14,15) |
| InChIKey | LANXJAXRTRGYQN-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.73 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|