C12H16N6O — CID 66164316
[2-(3-cyclopropylimidazol-4-yl)-6-(methoxymethyl)pyrimidin-4-yl]hydrazine (PubChem CID 66164316) has the molecular formula C12H16N6O and a molecular weight of 260.30 g/mol. Its IUPAC name is [2-(3-cyclopropylimidazol-4-yl)-6-(methoxymethyl)pyrimidin-4-yl]hydrazine.
| Compound Name | [2-(3-cyclopropylimidazol-4-yl)-6-(methoxymethyl)pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 66164316 |
| Molecular Formula | C12H16N6O |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | [2-(3-cyclopropylimidazol-4-yl)-6-(methoxymethyl)pyrimidin-4-yl]hydrazine |
| SMILES | COCc1cc(NN)nc(-c2cncn2C2CC2)n1 |
| InChI | InChI=1S/C12H16N6O/c1-19-6-8-4-11(17-13)16-12(15-8)10-5-14-7-18(10)9-2-3-9/h4-5,7,9H,2-3,6,13H2,1H3,(H,15,16,17) |
| InChIKey | FQAONVPTSLHKJS-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 90.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|