C15H13ClN4S — CID 107125311
2-(5-chloro-1,3-thiazol-2-yl)-N-ethyl-6-phenylpyrimidin-4-amine (PubChem CID 107125311) has the molecular formula C15H13ClN4S and a molecular weight of 316.82 g/mol. Its IUPAC name is 2-(5-chloro-1,3-thiazol-2-yl)-N-ethyl-6-phenylpyrimidin-4-amine.
| Compound Name | 2-(5-chloro-1,3-thiazol-2-yl)-N-ethyl-6-phenylpyrimidin-4-amine |
|---|---|
| PubChem CID | 107125311 |
| Molecular Formula | C15H13ClN4S |
| Molecular Weight | 316.82 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | 2-(5-chloro-1,3-thiazol-2-yl)-N-ethyl-6-phenylpyrimidin-4-amine |
| SMILES | CCNc1cc(-c2ccccc2)nc(-c2ncc(Cl)s2)n1 |
| InChI | InChI=1S/C15H13ClN4S/c1-2-17-13-8-11(10-6-4-3-5-7-10)19-14(20-13)15-18-9-12(16)21-15/h3-9H,2H2,1H3,(H,17,19,20) |
| InChIKey | ZFVSJCRQDYHFHF-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.82 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |