C14H11ClN4S — CID 107125310
2-(5-chloro-1,3-thiazol-2-yl)-N-methyl-6-phenylpyrimidin-4-amine (PubChem CID 107125310) has the molecular formula C14H11ClN4S and a molecular weight of 302.79 g/mol. Its IUPAC name is 2-(5-chloro-1,3-thiazol-2-yl)-N-methyl-6-phenylpyrimidin-4-amine.
| Compound Name | 2-(5-chloro-1,3-thiazol-2-yl)-N-methyl-6-phenylpyrimidin-4-amine |
|---|---|
| PubChem CID | 107125310 |
| Molecular Formula | C14H11ClN4S |
| Molecular Weight | 302.79 g/mol |
| Exact Mass | 302.04 |
| IUPAC Name | 2-(5-chloro-1,3-thiazol-2-yl)-N-methyl-6-phenylpyrimidin-4-amine |
| SMILES | CNc1cc(-c2ccccc2)nc(-c2ncc(Cl)s2)n1 |
| InChI | InChI=1S/C14H11ClN4S/c1-16-12-7-10(9-5-3-2-4-6-9)18-13(19-12)14-17-8-11(15)20-14/h2-8H,1H3,(H,16,18,19) |
| InChIKey | CZODLJMLQKLQPE-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.79 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |