C14H12ClN5S — CID 107125450
[2-(5-chloro-1,3-thiazol-2-yl)-5-methyl-6-phenylpyrimidin-4-yl]hydrazine (PubChem CID 107125450) has the molecular formula C14H12ClN5S and a molecular weight of 317.81 g/mol. Its IUPAC name is [2-(5-chloro-1,3-thiazol-2-yl)-5-methyl-6-phenylpyrimidin-4-yl]hydrazine.
| Compound Name | [2-(5-chloro-1,3-thiazol-2-yl)-5-methyl-6-phenylpyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 107125450 |
| Molecular Formula | C14H12ClN5S |
| Molecular Weight | 317.81 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | [2-(5-chloro-1,3-thiazol-2-yl)-5-methyl-6-phenylpyrimidin-4-yl]hydrazine |
| SMILES | Cc1c(NN)nc(-c2ncc(Cl)s2)nc1-c1ccccc1 |
| InChI | InChI=1S/C14H12ClN5S/c1-8-11(9-5-3-2-4-6-9)18-13(19-12(8)20-16)14-17-7-10(15)21-14/h2-7H,16H2,1H3,(H,18,19,20) |
| InChIKey | ZUTZZAWWKQVHCU-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.81 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|