C15H13N5 — CID 6405036
(3,6-diphenyl-1,2,4-triazin-5-yl)hydrazine (PubChem CID 6405036) has the molecular formula C15H13N5 and a molecular weight of 263.30 g/mol. Its IUPAC name is (3,6-diphenyl-1,2,4-triazin-5-yl)hydrazine.
| Compound Name | (3,6-diphenyl-1,2,4-triazin-5-yl)hydrazine |
|---|---|
| PubChem CID | 6405036 |
| Molecular Formula | C15H13N5 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | (3,6-diphenyl-1,2,4-triazin-5-yl)hydrazine |
| SMILES | NNc1nc(-c2ccccc2)nnc1-c1ccccc1 |
| InChI | InChI=1S/C15H13N5/c16-18-15-13(11-7-3-1-4-8-11)19-20-14(17-15)12-9-5-2-6-10-12/h1-10H,16H2,(H,17,18,20) |
| InChIKey | QZHYAYXHTBRUIB-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|