C13H11N5 — CID 10490033
(8-phenylpyrido[2,3-d]pyridazin-5-yl)hydrazine (PubChem CID 10490033) has the molecular formula C13H11N5 and a molecular weight of 237.27 g/mol. Its IUPAC name is (8-phenylpyrido[2,3-d]pyridazin-5-yl)hydrazine.
| Compound Name | (8-phenylpyrido[2,3-d]pyridazin-5-yl)hydrazine |
|---|---|
| PubChem CID | 10490033 |
| Molecular Formula | C13H11N5 |
| Molecular Weight | 237.27 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | (8-phenylpyrido[2,3-d]pyridazin-5-yl)hydrazine |
| SMILES | NNc1nnc(-c2ccccc2)c2ncccc12 |
| InChI | InChI=1S/C13H11N5/c14-16-13-10-7-4-8-15-12(10)11(17-18-13)9-5-2-1-3-6-9/h1-8H,14H2,(H,16,18) |
| InChIKey | AQLRYDTXOPUXIM-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.27 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|