About 5-phenylpyrazino[2,3-d]pyridazine-8-carbonitrile
5-phenylpyrazino[2,3-d]pyridazine-8-carbonitrile (PubChem CID 162717722) has the molecular formula C13H7N5
and a molecular weight of 233.23 g/mol. Its IUPAC name is 5-phenylpyrazino[2,3-d]pyridazine-8-carbonitrile.
Molecular Properties
| Compound Name | 5-phenylpyrazino[2,3-d]pyridazine-8-carbonitrile |
| PubChem CID | 162717722 |
| Molecular Formula | C13H7N5 |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | 5-phenylpyrazino[2,3-d]pyridazine-8-carbonitrile |
| SMILES | N#Cc1nnc(-c2ccccc2)c2nccnc12 |
| InChI | InChI=1S/C13H7N5/c14-8-10-12-13(16-7-6-15-12)11(18-17-10)9-4-2-1-3-5-9/h1-7H |
| InChIKey | RSUARBWQFVIAJE-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 75.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-phenylpyrazino[2,3-d]pyridazine-8-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-phenylpyrazino[2,3-d]pyridazine-8-carbonitrile?
The IUPAC name of 5-phenylpyrazino[2,3-d]pyridazine-8-carbonitrile (CID 162717722) is 5-phenylpyrazino[2,3-d]pyridazine-8-carbonitrile.
What is the SMILES notation for 5-phenylpyrazino[2,3-d]pyridazine-8-carbonitrile?
The canonical SMILES for 5-phenylpyrazino[2,3-d]pyridazine-8-carbonitrile is N#Cc1nnc(-c2ccccc2)c2nccnc12.
What is the InChIKey of 5-phenylpyrazino[2,3-d]pyridazine-8-carbonitrile?
The InChIKey is RSUARBWQFVIAJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H7N5/c14-8-10-12-13(16-7-6-15-12)11(18-17-10)9-4-2-1-3-5-9/h1-7H.
What are the key properties of 5-phenylpyrazino[2,3-d]pyridazine-8-carbonitrile?
5-phenylpyrazino[2,3-d]pyridazine-8-carbonitrile has a molecular weight of 233.23 g/mol, XLogP of 1.96, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-phenylpyrazino[2,3-d]pyridazine-8-carbonitrile is sourced from PubChem (CID 162717722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).