C22H15N5 — CID 67731671
2,2-bis(3-phenylpyrazin-2-yl)acetonitrile (PubChem CID 67731671) has the molecular formula C22H15N5 and a molecular weight of 349.40 g/mol. Its IUPAC name is 2,2-bis(3-phenylpyrazin-2-yl)acetonitrile.
| Compound Name | 2,2-bis(3-phenylpyrazin-2-yl)acetonitrile |
|---|---|
| PubChem CID | 67731671 |
| Molecular Formula | C22H15N5 |
| Molecular Weight | 349.40 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | 2,2-bis(3-phenylpyrazin-2-yl)acetonitrile |
| SMILES | N#CC(c1nccnc1-c1ccccc1)c1nccnc1-c1ccccc1 |
| InChI | InChI=1S/C22H15N5/c23-15-18(21-19(24-11-13-26-21)16-7-3-1-4-8-16)22-20(25-12-14-27-22)17-9-5-2-6-10-17/h1-14,18H |
| InChIKey | PNCNRZCYKUCLJN-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 75.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.40 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |