About 2,2-bis(2-phenyl-3-pyridinyl)acetonitrile;ruthenium
2,2-bis(2-phenyl-3-pyridinyl)acetonitrile;ruthenium (PubChem CID 159648307) has the molecular formula C24H17N3Ru
and a molecular weight of 448.49 g/mol. Its IUPAC name is 2,2-bis(2-phenyl-3-pyridinyl)acetonitrile;ruthenium.
Molecular Properties
| Compound Name | 2,2-bis(2-phenyl-3-pyridinyl)acetonitrile;ruthenium |
| PubChem CID | 159648307 |
| Molecular Formula | C24H17N3Ru |
| Molecular Weight | 448.49 g/mol |
| Exact Mass | 449.05 |
| IUPAC Name | 2,2-bis(2-phenyl-3-pyridinyl)acetonitrile;ruthenium |
| SMILES | N#CC(c1cccnc1-c1ccccc1)c1cccnc1-c1ccccc1.[Ru] |
| InChI | InChI=1S/C24H17N3.Ru/c25-17-22(20-13-7-15-26-23(20)18-9-3-1-4-10-18)21-14-8-16-27-24(21)19-11-5-2-6-12-19;/h1-16,22H; |
| InChIKey | MRFTYGPHRNVSEU-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 448.49 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,2-bis(2-phenyl-3-pyridinyl)acetonitrile;ruthenium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-bis(2-phenyl-3-pyridinyl)acetonitrile;ruthenium?
The IUPAC name of 2,2-bis(2-phenyl-3-pyridinyl)acetonitrile;ruthenium (CID 159648307) is 2,2-bis(2-phenyl-3-pyridinyl)acetonitrile;ruthenium.
What is the SMILES notation for 2,2-bis(2-phenyl-3-pyridinyl)acetonitrile;ruthenium?
The canonical SMILES for 2,2-bis(2-phenyl-3-pyridinyl)acetonitrile;ruthenium is N#CC(c1cccnc1-c1ccccc1)c1cccnc1-c1ccccc1.[Ru].
What is the InChIKey of 2,2-bis(2-phenyl-3-pyridinyl)acetonitrile;ruthenium?
The InChIKey is MRFTYGPHRNVSEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H17N3.Ru/c25-17-22(20-13-7-15-26-23(20)18-9-3-1-4-10-18)21-14-8-16-27-24(21)19-11-5-2-6-12-19;/h1-16,22H;.
What are the key properties of 2,2-bis(2-phenyl-3-pyridinyl)acetonitrile;ruthenium?
2,2-bis(2-phenyl-3-pyridinyl)acetonitrile;ruthenium has a molecular weight of 448.49 g/mol, XLogP of 5.46, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-bis(2-phenyl-3-pyridinyl)acetonitrile;ruthenium is sourced from PubChem (CID 159648307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).