C24H17N3Ru — CID 159648307
2,2-bis(2-phenyl-3-pyridinyl)acetonitrile;ruthenium (PubChem CID 159648307) has the molecular formula C24H17N3Ru and a molecular weight of 448.49 g/mol. Its IUPAC name is 2,2-bis(2-phenyl-3-pyridinyl)acetonitrile;ruthenium.
| Compound Name | 2,2-bis(2-phenyl-3-pyridinyl)acetonitrile;ruthenium |
|---|---|
| PubChem CID | 159648307 |
| Molecular Formula | C24H17N3Ru |
| Molecular Weight | 448.49 g/mol |
| Exact Mass | 449.05 |
| IUPAC Name | 2,2-bis(2-phenyl-3-pyridinyl)acetonitrile;ruthenium |
| SMILES | N#CC(c1cccnc1-c1ccccc1)c1cccnc1-c1ccccc1.[Ru] |
| InChI | InChI=1S/C24H17N3.Ru/c25-17-22(20-13-7-15-26-23(20)18-9-3-1-4-10-18)21-14-8-16-27-24(21)19-11-5-2-6-12-19;/h1-16,22H; |
| InChIKey | MRFTYGPHRNVSEU-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.49 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |