C14H10ClN3 — CID 10634780
5-chloro-8-(4-methylphenyl)pyrido[2,3-d]pyridazine (PubChem CID 10634780) has the molecular formula C14H10ClN3 and a molecular weight of 255.71 g/mol. Its IUPAC name is 5-chloro-8-(4-methylphenyl)pyrido[2,3-d]pyridazine.
| Compound Name | 5-chloro-8-(4-methylphenyl)pyrido[2,3-d]pyridazine |
|---|---|
| PubChem CID | 10634780 |
| Molecular Formula | C14H10ClN3 |
| Molecular Weight | 255.71 g/mol |
| Exact Mass | 255.06 |
| IUPAC Name | 5-chloro-8-(4-methylphenyl)pyrido[2,3-d]pyridazine |
| SMILES | Cc1ccc(-c2nnc(Cl)c3cccnc23)cc1 |
| InChI | InChI=1S/C14H10ClN3/c1-9-4-6-10(7-5-9)12-13-11(3-2-8-16-13)14(15)18-17-12/h2-8H,1H3 |
| InChIKey | FQLLXVKVXDGBLU-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.71 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |