C16H12N4 — CID 11425448
2,3-dimethylpyrazino[2,3-f][4,7]phenanthroline (PubChem CID 11425448) has the molecular formula C16H12N4 and a molecular weight of 260.30 g/mol. Its IUPAC name is 2,3-dimethylpyrazino[2,3-f][4,7]phenanthroline.
| Compound Name | 2,3-dimethylpyrazino[2,3-f][4,7]phenanthroline |
|---|---|
| PubChem CID | 11425448 |
| Molecular Formula | C16H12N4 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | 2,3-dimethylpyrazino[2,3-f][4,7]phenanthroline |
| SMILES | Cc1nc2c3ncccc3c3cccnc3c2nc1C |
| InChI | InChI=1S/C16H12N4/c1-9-10(2)20-16-14-12(6-4-8-18-14)11-5-3-7-17-13(11)15(16)19-9/h3-8H,1-2H3 |
| InChIKey | CMDDNHJJDHJINL-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|